BROMOBIS(DIMETHYLAMINO)BORANE structure
|
Common Name | BROMOBIS(DIMETHYLAMINO)BORANE | ||
|---|---|---|---|---|
| CAS Number | 6990-27-8 | Molecular Weight | 178.86600 | |
| Density | 1.259 g/mL at 25ºC(lit.) | Boiling Point | 20-28ºC0.5 mm Hg(lit.) | |
| Molecular Formula | C4H12BBrN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129 °F | |
| Name | N-[bromo(dimethylamino)boranyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 20-28ºC0.5 mm Hg(lit.) |
| Molecular Formula | C4H12BBrN2 |
| Molecular Weight | 178.86600 |
| Flash Point | 129 °F |
| Exact Mass | 178.02800 |
| PSA | 6.48000 |
| LogP | 0.48940 |
| Index of Refraction | n20/D 1.478(lit.) |
| Hazard Codes | C |
|---|---|
| Risk Phrases | 10-14-34 |
| Safety Phrases | 16-26-36/37/39-45 |
| RIDADR | UN 3398 4.3/PG 1 |
| HS Code | 2931900090 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Bromobis(dimethylamino)borane |
| MFCD00464744 |
| Brom-bis-<dimethylamino>-boran |
| Bor-bis(dimethylamino)-bromid |
| Bis(dimethylamino)bromoboran |
| bis(dimethylamido)boron bromide |
| Boranediamine,1-bromo-N,N,N',N'-tetramethyl |
| Bis-(dimethylamino)-borbromid |
| InChI=1/C4H12BBrN2/c1-7(2)5(6)8(3)4/h1-4H |
| 1-Bromo-N,N,N inverted exclamation marka,N inverted exclamation marka-tetramethylboranediamine |
| Bis-(dimethylamino)-bromboran |