| Name | N-[bromo(dimethylamino)boranyl]-N-methylmethanamine |
|---|---|
| Synonyms |
Bromobis(dimethylamino)borane
MFCD00464744 Brom-bis-<dimethylamino>-boran Bor-bis(dimethylamino)-bromid Bis(dimethylamino)bromoboran bis(dimethylamido)boron bromide Boranediamine,1-bromo-N,N,N',N'-tetramethyl Bis-(dimethylamino)-borbromid InChI=1/C4H12BBrN2/c1-7(2)5(6)8(3)4/h1-4H 1-Bromo-N,N,N inverted exclamation marka,N inverted exclamation marka-tetramethylboranediamine Bis-(dimethylamino)-bromboran |
| Density | 1.259 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 20-28ºC0.5 mm Hg(lit.) |
| Molecular Formula | C4H12BBrN2 |
| Molecular Weight | 178.86600 |
| Flash Point | 129 °F |
| Exact Mass | 178.02800 |
| PSA | 6.48000 |
| LogP | 0.48940 |
| Index of Refraction | n20/D 1.478(lit.) |
| Hazard Codes | C |
|---|---|
| Risk Phrases | 10-14-34 |
| Safety Phrases | 16-26-36/37/39-45 |
| RIDADR | UN 3398 4.3/PG 1 |
| HS Code | 2931900090 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |