WAY-325163 structure
|
Common Name | WAY-325163 | ||
|---|---|---|---|---|
| CAS Number | 685845-90-3 | Molecular Weight | 388.87 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H17ClN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-325163Human 5-lipoxygenase (5-LOX) inhibitor |
| Name | WAY-325163 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.87 |
| Exact Mass | 388.076080 |
| LogP | 4.64 |
| Index of Refraction | 1.752 |
| InChIKey | MNTADZSGXZWTGJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1NC(=O)Cn1nnc2sc3c(c2c1=O)CCCC3 |
| N-(4-Chloro-2-methylphenyl)-2-(4-oxo-5,6,7,8-tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-3(4H)-yl)acetamide |
| [1]Benzothieno[2,3-d]-1,2,3-triazine-3(4H)-acetamide, N-(4-chloro-2-methylphenyl)-5,6,7,8-tetrahydro-4-oxo- |