WAY-352851 structure
|
Common Name | WAY-352851 | ||
|---|---|---|---|---|
| CAS Number | 685113-18-2 | Molecular Weight | 309.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13ClFN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-352851antagonists for the adenosine A1 and A3 receptors; antagonists for the adenosine A1 and A3 receptors; |
| Name | WAY-352851 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13ClFN3S |
|---|---|
| Molecular Weight | 309.79 |
| Thiourea, N-(3-chloro-4-fluorophenyl)-N'-[2-(2-pyridinyl)ethyl]- |