10-Oxo Morphine structure
|
Common Name | 10-Oxo Morphine | ||
|---|---|---|---|---|
| CAS Number | 68254-48-8 | Molecular Weight | 299.32100 | |
| Density | 1.53g/cm3 | Boiling Point | 557ºC at 760 mmHg | |
| Molecular Formula | C17H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.6ºC | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
| Name | 10-Oxo Morphine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 557ºC at 760 mmHg |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.32100 |
| Flash Point | 290.6ºC |
| Exact Mass | 299.11600 |
| PSA | 70.00000 |
| LogP | 0.77620 |
| Index of Refraction | 1.735 |
| InChIKey | HNJBQZPKNKFLFM-CBEJNMEVSA-N |
| SMILES | CN1CCC23c4c5ccc(O)c4OC2C(O)C=CC3C1C5=O |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
|
Impurities in a morphine sulfate drug product identified as 5-(hydroxymethyl)-2-furfural, 10-hydroxymorphine and 10-oxomorphine.
J. Pharm. Sci. 92(3) , 485-93, (2003) Stability testing of morphine sulfate formulated with nonpareil sugar seeds (consisting of sucrose and starch) and fumaric acid revealed the formation of the three impurities 5-(hydroxymethyl)-2-furfu... |
|
|
Synthesis and determination of 10-oxomorphine, a decomposition product of morphine.
Pharmazie 39(10) , 687-8, (1984) 10-Oxomorphine, a decomposition product of morphine, was synthesized from 6-O-acetylcodeine, which was oxidized with chromic acid to 6-O-acetyl-10-hydroxycodeine. This substance was then oxidized with... |
| 10-Oxomorphine |
| 10-Oxomorphine (10-Ketomorphine) |
| (5a,6a)-7,8-Didehydro-4,5-epoxy-3,6-dihydroxy-17-methylmorphinan-10-on |
| (5a,6a)-7,8-Didehydro-4,5-epoxy-3,6-dihydroxy-17-methylmorphinan-10-one |