WAY-325010 structure
|
Common Name | WAY-325010 | ||
|---|---|---|---|---|
| CAS Number | 670259-16-2 | Molecular Weight | 434.44 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 652.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C23H15FN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 348.2±34.3 °C | |
Use of WAY-325010AKS1 inhibitor |
| Name | WAY-325010 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 652.2±65.0 °C at 760 mmHg |
| Molecular Formula | C23H15FN2O4S |
| Molecular Weight | 434.44 |
| Flash Point | 348.2±34.3 °C |
| Exact Mass | 434.073669 |
| LogP | 1.83 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.740 |
| InChIKey | BTEJGTMVORRRKC-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)cc2c3c(c(NS(=O)(=O)c4ccc(F)cc4)ccc31)C(=O)c1ccccc1-2 |
| Benzenesulfonamide, N-(2,7-dihydro-3-methyl-2,7-dioxo-3H-naphtho[1,2,3-de]quinolin-6-yl)-4-fluoro- |
| 4-Fluoro-N-(3-methyl-2,7-dioxo-2,7-dihydro-3H-naphtho[1,2,3-de]quinolin-6-yl)benzenesulfonamide |