1,5-Dimethyl-5-isopentylbarbituric acid
Modify Date: 2025-08-25 23:22:59
1,5-Dimethyl-5-isopentylbarbituric acid structure
|
Common Name | 1,5-Dimethyl-5-isopentylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 66941-05-7 | Molecular Weight | 226.27200 | |
| Density | 1.083g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dimethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.27200 |
| Exact Mass | 226.13200 |
| PSA | 69.97000 |
| LogP | 1.35090 |
| Index of Refraction | 1.469 |
| InChIKey | XGDMEGQASJYJGY-UHFFFAOYSA-N |
| SMILES | CC(C)CCC1(C)C(=O)NC(=O)N(C)C1=O |
|
~%
1,5-Dimethyl-5-... CAS#:66941-05-7 |
| Literature: Shonle; Doran Journal of the American Chemical Society, 1936 , vol. 58, p. 1358 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| BARBITURIC ACID,1,5-DIMETHYL-5-ISOPENTYL |
| 5-isopentyl-1,5-dimethyl-barbituric acid |
| 5-Isopentyl-1,5-dimethyl-barbitursaeure |
| 1,5-Dimethyl-5-isopentylbarbituric acid |