1,5-Dimethyl-5-(1-ethylpropyl)barbituric acid structure
|
Common Name | 1,5-Dimethyl-5-(1-ethylpropyl)barbituric acid | ||
|---|---|---|---|---|
| CAS Number | 66941-00-2 | Molecular Weight | 226.27200 | |
| Density | 1.095g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dimethyl-5-pentan-3-yl-1,3-diazinane-2,4,6-trione |
|---|
| Density | 1.095g/cm3 |
|---|---|
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.27200 |
| Exact Mass | 226.13200 |
| PSA | 69.97000 |
| LogP | 1.35090 |
| Index of Refraction | 1.475 |
| InChIKey | UOYFVXJIGHQGPI-UHFFFAOYSA-N |
| SMILES | CCC(CC)C1(C)C(=O)NC(=O)N(C)C1=O |
|
~%
1,5-Dimethyl-5-... CAS#:66941-00-2 |
| Literature: Tabern; Volwiler Journal of the American Chemical Society, 1936 , vol. 58, p. 1354 Full Text View citing articles Show Details Abbott Labor Patent: US2152512 , 1933 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |