WAY-324127 structure
|
Common Name | WAY-324127 | ||
|---|---|---|---|---|
| CAS Number | 667410-33-5 | Molecular Weight | 387.43 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-324127retain FOXO1 in the nucleus; anti-tumor activity; |
| Name | WAY-324127 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.43 |
| Exact Mass | 387.158295 |
| LogP | 4.39 |
| Index of Refraction | 1.673 |
| InChIKey | ZMORGOHEONZHTB-UHFFFAOYSA-N |
| SMILES | COc1ccccc1OCC(=O)Nc1cc(-c2nc3ccccc3[nH]2)ccc1C |
| Acetamide, N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-2-(2-methoxyphenoxy)- |
| N-[5-(1H-Benzimidazol-2-yl)-2-methylphenyl]-2-(2-methoxyphenoxy)acetamide |