(R)-5-O-Benzoyl-1,2-di-O-isopropylidene-alpha-D-xylofuranose structure
|
Common Name | (R)-5-O-Benzoyl-1,2-di-O-isopropylidene-alpha-D-xylofuranose | ||
|---|---|---|---|---|
| CAS Number | 6612-91-5 | Molecular Weight | 294.30 | |
| Density | 1.253 g/cm3 | Boiling Point | 432ºC at 760 mmHg | |
| Molecular Formula | C15H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.2ºC | |
Use of (R)-5-O-Benzoyl-1,2-di-O-isopropylidene-alpha-D-xylofuranose(R)-5-O-Benzoyl-1,2-di-O-isopropylidene-alpha-D-xylofuranose is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | (6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-5-O-Benzoyl-1,2-di-O-isopropylidene-alpha-D-xylofuranose is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.253 g/cm3 |
|---|---|
| Boiling Point | 432ºC at 760 mmHg |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 |
| Flash Point | 159.2ºC |
| Exact Mass | 294.11000 |
| PSA | 74.22000 |
| LogP | 1.08070 |
| InChIKey | WKRBIHIDJVMVGS-HKUMRIAESA-N |
| SMILES | CC1(C)OC2OC(COC(=O)c3ccccc3)C(O)C2O1 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| 1,2-O-Isopropyliden-6-O-benzoyl-D-glucofuranose |
| 5-O-CARBOMETHOXY-1,2-O-ISOPROPYLIDENE-D-XYLOFURANO |
| 1,2-O-isopropylidene-5-O-methoxycarbonyl-D-xylofuranose |
| 5-O-carbomethoxy-1,2-O-isopropylidene-*D-xylofura |
| 5-O-Benzoyl-1,2-O-isopropyliden-D-ribofuranose |
| 5-O-Carbomethoxy-1,2-O-isopropylidene-a-D-xylofuranose |