4-Nitrophenyltrifluoracetat structure
|
Common Name | 4-Nitrophenyltrifluoracetat | ||
|---|---|---|---|---|
| CAS Number | 658-78-6 | Molecular Weight | 235.117 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 246.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F3NO4 | Melting Point | 35-39 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 97.2±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitrophenyl Trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 246.0±0.0 °C at 760 mmHg |
| Melting Point | 35-39 °C(lit.) |
| Molecular Formula | C8H4F3NO4 |
| Molecular Weight | 235.117 |
| Flash Point | 97.2±27.3 °C |
| Exact Mass | 235.009247 |
| PSA | 72.12000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | JFOIBTLTZWOAIC-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2915900090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Acetic acid, 2,2,2-trifluoro-, 4-nitrophenyl ester |
| MFCD00007324 |
| 4-Nitrophenyl-trifluoroacetate |
| Trifluoroacetic acid p-nitrophenyl ester |
| (4-nitrophenyl) 2,2,2-trifluoroacetate |
| p-Nitrophenyl trifluoroacetate |
| Acetic acid, trifluoro-, p-nitrophenyl ester |
| 4-Nitrophenyltrifluoracetat |
| Acetic acid, trifluoro-, 4-nitrophenyl ester |
| EINECS 211-524-6 |
| 4-Nitrophenyl trifluoroacetate |