(4-nitrophenyl) 2-ethoxyprop-2-enoate structure
|
Common Name | (4-nitrophenyl) 2-ethoxyprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 108818-44-6 | Molecular Weight | 237.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) 2-ethoxyprop-2-enoate |
|---|
| Molecular Formula | C11H11NO5 |
|---|---|
| Molecular Weight | 237.20900 |
| Exact Mass | 237.06400 |
| PSA | 81.35000 |
| LogP | 2.57360 |
| InChIKey | PTEPHUXVNNEEAV-UHFFFAOYSA-N |
| SMILES | C=C(OCC)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~84%
(4-nitrophenyl)... CAS#:108818-44-6 |
| Literature: LaMattina, John L.; Muse, David E. Journal of Organic Chemistry, 1987 , vol. 52, # 15 p. 3479 - 3481 |
|
~%
(4-nitrophenyl)... CAS#:108818-44-6 |
| Literature: LaMattina, John L.; Muse, David E. Journal of Organic Chemistry, 1987 , vol. 52, # 15 p. 3479 - 3481 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |