Trifluoroacetic anhydride structure
|
Common Name | Trifluoroacetic anhydride | ||
|---|---|---|---|---|
| CAS Number | 407-25-0 | Molecular Weight | 210.031 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 39.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C4F6O3 | Melting Point | -63.5 °C | |
| MSDS | Chinese USA | Flash Point | -26.1±20.8 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Trifluoroacetic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 39.5±0.0 °C at 760 mmHg |
| Melting Point | -63.5 °C |
| Molecular Formula | C4F6O3 |
| Molecular Weight | 210.031 |
| Flash Point | -26.1±20.8 °C |
| Exact Mass | 209.975159 |
| PSA | 43.37000 |
| LogP | 2.56 |
| Vapour Pressure | 438.6±0.0 mmHg at 25°C |
| Index of Refraction | 1.291 |
| InChIKey | QAEDZJGFFMLHHQ-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| Stability | Stable, but moisture sensitive. Reacts with water to liberate hydrogen (flammable!). Incompatible with water, strong oxidizing agents. |
| Water Solubility | Hydrolysis |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H332 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US) |
| Hazard Codes | C:Corrosive |
| Risk Phrases | R14;R20;R35;R52/53 |
| Safety Phrases | S26-S36/37/39-S43-S45-S61-S9-S8-S28A-S27 |
| RIDADR | UN 3265 8/PG 1 |
| WGK Germany | 2 |
| RTECS | AJ9800000 |
| Packaging Group | I |
| Hazard Class | 8 |
| HS Code | 29159080 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Determination of low levels of benzodiazepines and their metabolites in urine by hollow-fiber liquid-phase microextraction (LPME) and gas chromatography-mass spectrometry (GC-MS).
J. Chromatogr. B. Analyt. Technol. Biomed. Life Sci. 975 , 24-33, (2014) In this study, it is shown a method for the determination of benzodiazepines and their main metabolites in urine samples by hollow-fiber liquid-phase microextraction (LPME) in the three-phase mode. In... |
|
|
Toxicological findings in a fatal multidrug intoxication involving mephedrone.
Forensic Sci. Int. 243 , 68-73, (2014) The distribution of mephedrone in the body fluids and tissues of a subject found dead after the concomitant intake of cocaine and mephedrone is reported. Mephedrone (4-methylmethcathinone) is a design... |
|
|
Surfactant protein C metabolism in human infants and adult patients by stable isotope tracer and mass spectrometry.
Anal. Bioanal. Chem 406(25) , 6225-33, (2014) Surfactant protein C (SP-C) is deemed as the surfactant protein most specifically expressed in type II alveolar epithelial cells and plays an important role in surfactant function. SP-C turnover in hu... |
| trifluoro acetic anhydride |
| trifluoroacetic |
| TRIFLUORACETIC ANHYDRIDE |
| Trifluoroacetyl anhydride |
| Perfluoracetic anhydride |
| trifluoroacetylanhydride |
| perfluoroaceticanhydride |
| MFCD00000416 |
| Trifluoromethanesulfonic acid |
| 2,2,2-trifluoroacetic anhydride |
| Trifluoroacetic Anhydride (TFAA) |
| hexafluoroacetic anhydride |
| Trifluoroacetic acid anhydride |
| EINECS 206-982-9 |
| bis-trifluoroacetic anhydride |
| TFAA |
| Trifluoroacetic anhy |
| Perfluoroacetic anhydride |
| Trifluoroacetic anhydride |
| RIFLUOROACETIC ANHYDRIDE |
| TRIFLUOROACETO ANHYDRIDE |
| TIFLUOROACETIC ANHYDRIDE |