1-(3-METHOXY-PHENYL)-BUTANE-1,3-DIONE structure
|
Common Name | 1-(3-METHOXY-PHENYL)-BUTANE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 65547-50-4 | Molecular Weight | 222.23700 | |
| Density | 1.116g/cm3 | Boiling Point | 344.1ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.8ºC | |
| Name | 1-(2,5-dimethoxyphenyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 344.1ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 151.8ºC |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 1.86560 |
| Index of Refraction | 1.503 |
| InChIKey | IWGWZCMYHSKSRE-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)CC(C)=O)c1 |
| HS Code | 2914509090 |
|---|
|
~%
1-(3-METHOXY-PH... CAS#:65547-50-4 |
| Literature: Wiley Journal of the American Chemical Society, 1952 , vol. 74, p. 4326 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3-Butanedione,1-(2,5-dimethoxyphenyl) |
| 1-(2,5-Dimethoxyphenyl)-1,3-butanedione |
| 1-(2,5-Dimethoxy-phenyl)-butan-1,3-dion |
| 1-(2,5-dimethoxy-phenyl)-butane-1,3-dione |
| 2.5-Dimethoxybenzoylaceton |