4,4,4-trifluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione
Modify Date: 2025-12-01 08:53:22
4,4,4-trifluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione structure
|
Common Name | 4,4,4-trifluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 70862-63-4 | Molecular Weight | 264.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4,4-trifluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8F4O3 |
|---|---|
| Molecular Weight | 264.17300 |
| Exact Mass | 264.04100 |
| PSA | 43.37000 |
| LogP | 2.53850 |
| InChIKey | RQGDMUVAUOVABM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC(=O)C(F)(F)F)cc1F |
|
~%
4,4,4-trifluoro... CAS#:70862-63-4 |
| Literature: Joshi; Pathak; Garg Journal of the Indian Chemical Society, 1983 , vol. 60, # 11 p. 1074 - 1076 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-fluoro-4-methoxybenzoyltrifluoroacetone |
| 1,3-Butanedione,4,4,4-trifluoro-1-(3-fluoro-4-methoxyphenyl) |
| 1-(3-fluoro-4-methoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
| 4,4,4-trifluoro-1-(3-fluoro-4-methoxy-phenyl)-butane-1,3-dione |