4,4,4-TRIFLUORO-1-(3-METHOXY-PHENYL)-BUTANE-1,3-DIONE
Modify Date: 2025-08-22 15:48:12
4,4,4-TRIFLUORO-1-(3-METHOXY-PHENYL)-BUTANE-1,3-DIONE structure
|
Common Name | 4,4,4-TRIFLUORO-1-(3-METHOXY-PHENYL)-BUTANE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 57965-21-6 | Molecular Weight | 246.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 283.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O3 | Melting Point | 32-34 °C | |
| MSDS | N/A | Flash Point | 121.6±20.8 °C | |
| Name | 4,4,4-trifluoro-1-(3-methoxyphenyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.8±35.0 °C at 760 mmHg |
| Melting Point | 32-34 °C |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.183 |
| Flash Point | 121.6±20.8 °C |
| Exact Mass | 246.050385 |
| PSA | 43.37000 |
| LogP | 4.34 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | DIZYLXQPKFYSGQ-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)CC(=O)C(F)(F)F)c1 |
| HS Code | 2914700090 |
|---|
|
~%
4,4,4-TRIFLUORO... CAS#:57965-21-6 |
| Literature: European Journal of Medicinal Chemistry, , vol. 46, # 9 p. 4760 - 4767 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4,4,4-Trifluoro-1-(3-methoxyphenyl)butane-1,3-dione |
| 4,4,4-Trifluoro-1-(3-methoxyphenyl)-1,3-butanedione |
| 1,3-Butanedione, 4,4,4-trifluoro-1-(3-methoxyphenyl)- |