1-[4-hydroxy-3-trityloxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione structure
|
Common Name | 1-[4-hydroxy-3-trityloxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 6554-11-6 | Molecular Weight | 728.83 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C47H40N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-[4-hydroxy-3-trityloxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione2',5'-Bis-O-(triphenylMethyl)uridine is a uridine analog. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
| Name | Enzastaurin hcl |
|---|---|
| Synonym | More Synonyms |
| Description | 2',5'-Bis-O-(triphenylMethyl)uridine is a uridine analog. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C47H40N2O6 |
| Molecular Weight | 728.83 |
| Exact Mass | 728.28900 |
| PSA | 102.78000 |
| LogP | 7.18090 |
| Index of Refraction | 1.705 |
| InChIKey | DHKUAWARIDEGPI-UHFFFAOYSA-N |
| SMILES | O=c1ccn(C2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(O)C2OC(c2ccccc2)(c2ccccc2)c2ccccc2)c(=O)[nH]1 |
| 2',5'-Di-O-trityl-uridin |
| 2',5'-bis-O-trityluridine |
| Enzastaurin Hydrochloride |
| 2',5'-Bis-triphenylmethyl-pyrimidin-ribosid |
| 2',5'-di-O-trityluridine |
| 2',5'-ditrityluridine |
| O2',O5'-ditrityl-uridine |