N-Boc-N'-xanthyl-L-asparagine structure
|
Common Name | N-Boc-N'-xanthyl-L-asparagine | ||
|---|---|---|---|---|
| CAS Number | 65420-40-8 | Molecular Weight | 412.436 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 650.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H24N2O6 | Melting Point | 177.5-181.5 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 347.3±31.5 °C | |
| Name | N-Alpha-t-Boc-N-beta-xanthyl-L-asparagine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 650.7±55.0 °C at 760 mmHg |
| Melting Point | 177.5-181.5 °C(lit.) |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.436 |
| Flash Point | 347.3±31.5 °C |
| Exact Mass | 412.163422 |
| PSA | 113.96000 |
| LogP | 5.14 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | YMGDQLXBNMRJMR-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O |
| Storage condition | 2-8°C |
|
~35%
N-Boc-N'-xanthy... CAS#:65420-40-8 |
| Literature: Atherton, Eric; Caviezel, Mario; Fox, Hazel; Harkiss, Diana; Over, Hilary; Sheppard, Robert C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 1 p. 65 - 73 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| L-Asparagine, N-[(1,1-dimethylethoxy)carbonyl]-N-9H-xanthen-9-yl- |
| MFCD00066157 |
| N-(tert-Butoxycarbonyl)-N-9H-xanthen-9-yl-L-asparagine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-N-9H-xanthen-9-yl-L-asparagine |
| N-Boc-N'-xanthyl-L-asparagine |
| Boc-Asn(Xan)-OH |