N-Boc-N'-Cbz-L-2,3-diaminopropionic acid dicyclohexylamine salt structure
|
Common Name | N-Boc-N'-Cbz-L-2,3-diaminopropionic acid dicyclohexylamine salt | ||
|---|---|---|---|---|
| CAS Number | 65710-58-9 | Molecular Weight | 519.673 | |
| Density | N/A | Boiling Point | 548.7ºC at 760 mmHg | |
| Molecular Formula | C28H45N3O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 285.6ºC | |
| Name | Dicyclohexylamine (S)-3-(((benzyloxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 548.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C28H45N3O6 |
| Molecular Weight | 519.673 |
| Flash Point | 285.6ºC |
| Exact Mass | 519.330811 |
| PSA | 125.99000 |
| LogP | 6.30480 |
| Appearance of Characters | Solid |
| InChIKey | RPWGTQRQPVPFKR-YDALLXLXSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NC(CNC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | Store at RT. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 29242990 |
| 3-{[(Benzyloxy)carbonyl]amino}-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-alanine - N-cyclohexylcyclohexanamine (1:1) |
| N-cyclohexylcyclohexanamine,(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid |
| L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-3-[[(phenylmethoxy)carbonyl]amino]-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| MFCD00236880 |
| Boc-Dap(Z)-OH·DCHA |
| N-Boc-N'-Cbz-L-2,3-diaminopropionic acid dicyclohexylamine salt |