N-Boc-N'-(9-xanthenyl)-L-glutamine structure
|
Common Name | N-Boc-N'-(9-xanthenyl)-L-glutamine | ||
|---|---|---|---|---|
| CAS Number | 55260-24-7 | Molecular Weight | 426.462 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 669.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H26N2O6 | Melting Point | ~150 °C (dec.) | |
| MSDS | N/A | Flash Point | 358.9±31.5 °C | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 669.8±55.0 °C at 760 mmHg |
| Melting Point | ~150 °C (dec.) |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.462 |
| Flash Point | 358.9±31.5 °C |
| Exact Mass | 426.179077 |
| PSA | 113.96000 |
| LogP | 4.91 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | HOIIDGIJEPOSLL-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
|
~39%
N-Boc-N'-(9-xan... CAS#:55260-24-7 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 1 p. 65 - 73 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| BOC-Nd-XANTHYL-L-GLUTAMINE |
| L-Glutamine, N-[(1,1-dimethylethoxy)carbonyl]-N-9H-xanthen-9-yl- |
| MFCD00066158 |
| N-Boc-N'-xanthyl-L-glutamine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-N-9H-xanthen-9-yl-L-glutamine |
| AmbotzBAA1089 |
| N-(tert-Butoxycarbonyl)-N-9H-xanthen-9-yl-L-glutamine |
| N-Boc-N'-(9-xanthenyl)-L-glutamine |
| Boc-Gln(Xan)-OH |