UNII:CC64495H41 structure
|
Common Name | UNII:CC64495H41 | ||
|---|---|---|---|---|
| CAS Number | 6515-36-2 | Molecular Weight | 240.254 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 464.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | 188-190 °C(lit.) | |
| MSDS | N/A | Flash Point | 181.2±22.2 °C | |
Use of UNII:CC64495H417-Hydroxyflavanone is an aromatase (cytochrome P450 19; CYP19) inhibitor with an IC50 of 65 μM[1]. |
| Name | 7-hydroxyflavanone |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Hydroxyflavanone is an aromatase (cytochrome P450 19; CYP19) inhibitor with an IC50 of 65 μM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 65 μM (Aromatase)[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.3±45.0 °C at 760 mmHg |
| Melting Point | 188-190 °C(lit.) |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.254 |
| Flash Point | 181.2±22.2 °C |
| Exact Mass | 240.078644 |
| PSA | 46.53000 |
| LogP | 3.49 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | SWAJPHCXKPCPQZ-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)Oc2cc(O)ccc21 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-monohydroxyflavanone |
| 7-hydroxy-2-phenyl-4-chromanone |
| MFCD00017487 |
| 7-Hydroxyflavanone,7-Hydroxy-2-phenylchroman-4-one |
| 7-hydroxy-flavanone |
| 7-HYDROXY-2-PHENYL-CHROMAN-4-ONE |
| 7-HYDROXY-2-PHENYLCHROMAN-4-ONE |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-7-hydroxy-2-phenyl- |
| 7-hydroxyflavan-4-one |
| UNII:CC64495H41 |
| 7-HYDROXYFLAVANONE |
| HYDROXYFLAVANONE,7 |
| 7-Hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |