3-phenylumbelliferone structure
|
Common Name | 3-phenylumbelliferone | ||
|---|---|---|---|---|
| CAS Number | 6468-96-8 | Molecular Weight | 238.23800 | |
| Density | 1.34g/cm3 | Boiling Point | 471.8ºC at 760 mmHg | |
| Molecular Formula | C15H10O3 | Melting Point | 206-210ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 210.1ºC | |
| Name | 7-hydroxy-3-phenylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 471.8ºC at 760 mmHg |
| Melting Point | 206-210ºC(lit.) |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.23800 |
| Flash Point | 210.1ºC |
| Exact Mass | 238.06300 |
| PSA | 50.44000 |
| LogP | 3.16560 |
| Index of Refraction | 1.666 |
| InChIKey | RIPZCQZTVDNJHQ-UHFFFAOYSA-N |
| SMILES | O=c1oc2cc(O)ccc2cc1-c1ccccc1 |
| Water Solubility | DMF: soluble |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | C,Xi |
| Risk Phrases | R34 |
| Safety Phrases | 22-24/25-45-37/39-36/37/39-27-26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
O.S. Wolfbeis
Z. Naturforsch. A 32 , 1065, (1977)
|
| 7-Hydroxy-3-phenylcumarin |
| 7-Hydroxy-3-phenylcoumarin |
| 7-hydroxy-3-phenyl-2H-1-benzopyran-2-one |
| 3-Phenylumbelliferone |
| 3-phenyl 7-hydroxycoumarine |
| 7-hydroxy-3-phenyl-2H-chromen-2-one |
| 3-phenyl-7-hydroxycoumarin |