di-n-butyldiphenyltin structure
|
Common Name | di-n-butyldiphenyltin | ||
|---|---|---|---|---|
| CAS Number | 6452-61-5 | Molecular Weight | 387.13700 | |
| Density | 1.17 | Boiling Point | 270ºC(lit.) | |
| Molecular Formula | C20H28Sn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 110ºC | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | di-n-butyldiphenyltin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17 |
|---|---|
| Boiling Point | 270ºC(lit.) |
| Molecular Formula | C20H28Sn |
| Molecular Weight | 387.13700 |
| Flash Point | 110ºC |
| Exact Mass | 388.12100 |
| LogP | 4.84980 |
| Index of Refraction | 1.562 |
| InChIKey | DTYWIPLKZHQUMW-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H315-H319-H331-H335-H400 |
| Precautionary Statements | P261-P273-P280-P301 + P310-P305 + P351 + P338-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R23/24/25;R36/37/38;R50/53 |
| Safety Phrases | 26-27-45-60-61 |
| RIDADR | UN 2788 |
| WGK Germany | 3 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| dibutyl-diphenyl stannane |
| diphenyl-di-n-butyltin |
| dibutyldiphenyl-stannan |
| dibutyl diphenyl tin |
| DIBUTYLDIPHENYLTIN(IV) |
| Einecs 229-256-3 |
| di-n-butyldiphenylstannane |
| MFCD00031522 |
| TIN DIBUTYLDIPHENYL |