Methyl 3-nitrobenzoate structure
|
Common Name | Methyl 3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 618-95-1 | Molecular Weight | 181.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 284.7±13.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 78-80 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 136.8±21.8 °C | |
| Name | Methyl 3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.7±13.0 °C at 760 mmHg |
| Melting Point | 78-80 °C(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 136.8±21.8 °C |
| Exact Mass | 181.037506 |
| PSA | 72.12000 |
| LogP | 1.82 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | AXLYJLKKPUICKV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | insoluble |
| Safety Phrases | S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Conformationally biased P3 amide replacements of beta-secretase inhibitors.
Bioorg. Med. Chem. Lett. 16(3) , 641-4, (2006) We have synthesized and evaluated a series of conformationally biased P3 amide replacements based on an isophthalamide lead structure. The studies resulted in the identification of the beta-secretase ... |
| Benzoic acid,3-nitro-,methyl ester |
| 3-Nitrobenzoic acid methyl ester |
| Benzoic acid, m-nitro-, methyl ester (8CI) |
| EINECS 210-573-0 |
| 3-methoxycarbonyl-1-nitrobenzene |
| 3-carbomethoxynitrobenzene |
| m-Nitrobenzoic acid, methyl ester |
| m-Nitrobenzoic acid,methyl ester |
| Benzoic acid, m-nitro-, methyl ester |
| Benzoic acid,m-nitro-,methyl ester |
| Methyl 3-nitrobenzoate |
| Methyl m-nitrobenzoate |
| Benzoic acid, 3-nitro-, methyl ester |
| MFCD00007250 |