2-(3,4-dichlorophenyl)-5,7-dihydroxychromen-4-one structure
|
Common Name | 2-(3,4-dichlorophenyl)-5,7-dihydroxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 616205-91-5 | Molecular Weight | 323.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H8Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,4-dichlorophenyl)-5,7-dihydroxychromen-4-one |
|---|
| Molecular Formula | C15H8Cl2O4 |
|---|---|
| Molecular Weight | 323.12800 |
| Exact Mass | 321.98000 |
| PSA | 70.67000 |
| LogP | 4.17800 |
| InChIKey | NWKCKGDNVREMFQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(Cl)c(Cl)c2)oc2cc(O)cc(O)c12 |
|
~%
2-(3,4-dichloro... CAS#:616205-91-5 |
| Literature: Chang, Liu-Shuan; Li, Chun-Bao; Qin, Nan; Jin, Mei-Na; Duan, Hong-Quan Chemistry and Biodiversity, 2012 , vol. 9, # 1 p. 162 - 169 |
|
~%
2-(3,4-dichloro... CAS#:616205-91-5 |
| Literature: Chang, Liu-Shuan; Li, Chun-Bao; Qin, Nan; Jin, Mei-Na; Duan, Hong-Quan Chemistry and Biodiversity, 2012 , vol. 9, # 1 p. 162 - 169 |