Verbasoside structure
|
Common Name | Verbasoside | ||
|---|---|---|---|---|
| CAS Number | 61548-34-3 | Molecular Weight | 462.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VerbasosideDecaffeoylacteoside is an inhibitor of AChE/BChE/LOX with moderate activity[1]. |
| Name | decaffeoyl verbascoside |
|---|---|
| Synonym | More Synonyms |
| Description | Decaffeoylacteoside is an inhibitor of AChE/BChE/LOX with moderate activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H30O12 |
|---|---|
| Molecular Weight | 462.44500 |
| Exact Mass | 462.17400 |
| PSA | 198.76000 |
| InChIKey | DORPKYRPJIIARM-GYAWPQPFSA-N |
| SMILES | CC1OC(OC2C(O)C(CO)OC(OCCc3ccc(O)c(O)c3)C2O)C(O)C(O)C1O |
| decaffeoyl-verbascoside |
| decaffeoylverbasoside |
| (2S,3R,4R,5R,6S)-2-{(2R,3R,4S,5R,6R)-2-[2-(3,4-Dihydroxy-phenyl)-ethoxy]-3,5-dihydroxy-6-hydroxymethyl-tetrahydro-pyran-4-yloxy}-6-methyl-tetrahydro-pyran-3,4,5-triol |
| decaffeoylverbascoside |
| descaffeoylverbascoside |
| decaffeoylacteoside |
| bioside |