7,9-dihydro-7-methyl-1H-purine-2,6,8(3H)-trione structure
|
Common Name | 7,9-dihydro-7-methyl-1H-purine-2,6,8(3H)-trione | ||
|---|---|---|---|---|
| CAS Number | 612-37-3 | Molecular Weight | 182.14 | |
| Density | 1.73g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H6N4O3 | Melting Point | >300ºC(lit.) | |
| MSDS | USA | Flash Point | N/A | |
Use of 7,9-dihydro-7-methyl-1H-purine-2,6,8(3H)-trione7-Methyluric acid is a metabolite of caffeine. 7-Methyluric acid can be detected in urine[1]. |
| Name | 7-methyl-3,9-dihydropurine-2,6,8-trione |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Methyluric acid is a metabolite of caffeine. 7-Methyluric acid can be detected in urine[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.73g/cm3 |
|---|---|
| Melting Point | >300ºC(lit.) |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 |
| Exact Mass | 182.04400 |
| PSA | 103.51000 |
| Index of Refraction | 1.695 |
| InChIKey | YHNNPKUFPWLTOP-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c2[nH]c(=O)[nH]c(=O)c21 |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Methyl-harnsaeure |
| 7-Methyluric acid |
| 7-methyl-7,9-dihydro-3H-purine-2,6,8-trione |
| 7-methylurate |
| 7,9-Dihydro-7-methyl-1H-purine-2,6,8(3H)-trione |
| N7-methyluric acid |
| 7-methyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |