Chrysosplenetin structure
|
Common Name | Chrysosplenetin | ||
|---|---|---|---|---|
| CAS Number | 603-56-5 | Molecular Weight | 374.341 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 615.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7±25.0 °C | |
Use of ChrysosplenetinChrysosplenetin is one of the polymethoxylated flavonoids in Artemisia annua L. (Compositae) and other several Chinese herbs. Chrysosplenetin inhibits P-gp activity and reverses the up-regulated P-gp and MDR1 levels induced by artemisinin (ART). Chrysosplenetin significantly augments the rat plasma level and anti-malarial efficacy of ART, partially due to the uncompetitive inhibition effect of Chrysosplenetin on rat CYP3A[1]. |
| Name | chrysosplenetin |
|---|---|
| Synonym | More Synonyms |
| Description | Chrysosplenetin is one of the polymethoxylated flavonoids in Artemisia annua L. (Compositae) and other several Chinese herbs. Chrysosplenetin inhibits P-gp activity and reverses the up-regulated P-gp and MDR1 levels induced by artemisinin (ART). Chrysosplenetin significantly augments the rat plasma level and anti-malarial efficacy of ART, partially due to the uncompetitive inhibition effect of Chrysosplenetin on rat CYP3A[1]. |
|---|---|
| Related Catalog | |
| Target |
CYP3A |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 615.8±55.0 °C at 760 mmHg |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.341 |
| Flash Point | 222.7±25.0 °C |
| Exact Mass | 374.100159 |
| PSA | 107.59000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | NBVTYGIYKCPHQN-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)ccc1O |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
|
~%
Chrysosplenetin CAS#:603-56-5 |
| Literature: Brunet, Gunter; Ibrahim, Ragai K. Phytochemistry (Elsevier), 1980 , vol. 19, p. 741 - 746 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Chrysosplenetin |
| 4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy- |
| 5,3'-Dipropyl-biphenyl-2,4'-diol |
| chrysoplenitin |
| 4',5-dihydroxy-3,6,7,3'-tetramethoxyflavone |
| 3,6,7,3'-tetra-methylquercetagetin |
| 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy-4H-chromen-4-one |
| Tetrahydrohonokiol |
| Chrysosplenetin B |
| Tetrahydrohoenokiol |
| chrysosplenol B |
| Quercetagetin 3,6,7,3'-tetramethyl ether |
| 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy-4H-chrom en-4-one |