a,w-bis(trimethylammonium)hexane dichloride
a,w-bis(trimethylammonium)hexane dichloride structure
|
Common Name | a,w-bis(trimethylammonium)hexane dichloride | ||
|---|---|---|---|---|
| CAS Number | 60-25-3 | Molecular Weight | 273.286 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H30Cl2N2 | Melting Point | 292 °C(dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of a,w-bis(trimethylammonium)hexane dichlorideHexamethonium Chloride Dihydrate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | hexamethonium chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Hexamethonium Chloride Dihydrate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 292 °C(dec.) |
|---|---|
| Molecular Formula | C12H30Cl2N2 |
| Molecular Weight | 273.286 |
| Exact Mass | 272.178589 |
| InChIKey | PYIHTIJNCRKDBV-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCCCCC[N+](C)(C)C.[Cl-].[Cl-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| RTECS | BQ8650000 |
| HS Code | 2923900090 |
|
~%
a,w-bis(trimeth... CAS#:60-25-3 |
| Literature: Chemistry - A European Journal, , vol. 5, # 4 p. 1284 - 1290 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Nicotine stimulation increases proliferation and matrix metalloproteinases-2 and -28 expression in human dental pulp cells.
Life Sci. 135 , 49-54, (2015) Dental pulp is the specialized tissue responsible for maintaining tooth viability. When tooth mineralized matrix is damaged, pulp is exposed to a plethora of environmental stimuli. In particular, in s... |
|
|
A potentially novel nicotinic receptor in Aplysia neuroendocrine cells.
J. Neurophysiol. 112(2) , 446-62, (2014) Nicotinic receptors form a diverse group of ligand-gated ionotropic receptors with roles in both synaptic transmission and the control of excitability. In the bag cell neurons of Aplysia, acetylcholin... |
|
|
Neuronal somata and extrasomal compartments play distinct roles during synapse formation between Lymnaea neurons.
J. Neurosci. 34(34) , 11304-15, (2014) Proper synapse formation is pivotal for all nervous system functions. However, the precise mechanisms remain elusive. Moreover, compared with the neuromuscular junction, steps regulating the synaptoge... |
| chloor-hexaviet |
| hiohexchloride |
| hestriumchloride |
| methiumchloride |
| hexonchloride |
| hexonechloride |
| a,w-bis(trimethylammonium)hexane dichloride |
| 1,6-Di(trimethylammonium)hexamethylene dichloride |
| hexamethylene bis-(trimethyl ammonium) chloride |
| esomidchloride |
| MFCD00031563 |
| Hexa-N-methyl-N,N'-hexandiyl-di-ammonium,Dichlorid |
| hexa-N-methyl-N,N'-hexanediyl-di-ammonium,dichloride |
| 1,6-Hexanediaminium, N,N,N,N,N,N-hexamethyl-, chloride (1:2) |
| α,ω-Bis(trimethylammonium)hexane dichloride |
| hexametonchloride |
| N,N,N,N',N',N'-Hexamethylhexane-1,6-diaminium dichloride |
| bistriumchloride |
| N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dichloride |
| EINECS 200-465-1 |
| depressin |
| hexamethonium dichloride |