N'-Cbz-L-lysine tert-butyl ester hydrochloride structure
|
Common Name | N'-Cbz-L-lysine tert-butyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5978-22-3 | Molecular Weight | 372.887 | |
| Density | N/A | Boiling Point | 469.6ºC at 760 mmHg | |
| Molecular Formula | C18H29ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8ºC | |
Use of N'-Cbz-L-lysine tert-butyl ester hydrochlorideH-Lys(Z)-OtBu.HCl is a lysine derivative[1]. |
| Name | N'-Cbz-L-lysine tert-butyl ester hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | H-Lys(Z)-OtBu.HCl is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 469.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H29ClN2O4 |
| Molecular Weight | 372.887 |
| Flash Point | 237.8ºC |
| Exact Mass | 372.181580 |
| PSA | 90.65000 |
| LogP | 4.64530 |
| InChIKey | HEMZMPXAQORYDR-RSAXXLAASA-N |
| SMILES | CC(C)(C)OC(=O)C(N)CCCCNC(=O)OCc1ccccc1.Cl |
| Storage condition | -15°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Hexanaminium, 1-(1,1-dimethylethoxy)-1-oxo-6-[[(phenylmethoxy)carbonyl]amino]-, chloride, (2S)- (1:1) |
| tert-butyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate,hydrochloride |
| tert-Butyl N-[(benzyloxy)carbonyl]-L-lysinate hydrochloride (1:1) |
| (2S)-6-{[(Benzyloxy)carbonyl]amino}-1-[(2-methyl-2-propanyl)oxy]-1-oxo-2-hexanaminium chloride |
| MFCD00038898 |
| H-Lys(Z)-OtBu.HCl |
| H-Lys(z)-Obut HCl |
| N'-Cbz-L-lysine tert-butyl ester hydrochloride |
| H-LYS(Z)-OTBU HCL |