H-Lys(Z)-OMe.HCl structure
|
Common Name | H-Lys(Z)-OMe.HCl | ||
|---|---|---|---|---|
| CAS Number | 27894-50-4 | Molecular Weight | 330.807 | |
| Density | N/A | Boiling Point | 444.6ºC at 760mmHg | |
| Molecular Formula | C15H23ClN2O4 | Melting Point | 115-118°C | |
| MSDS | USA | Flash Point | 222.7ºC | |
Use of H-Lys(Z)-OMe.HClH-Lys(Z)-OMe.HCl is a lysine derivative[1]. |
| Name | h-lys(z)-ome hcl |
|---|---|
| Synonym | More Synonyms |
| Description | H-Lys(Z)-OMe.HCl is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 444.6ºC at 760mmHg |
|---|---|
| Melting Point | 115-118°C |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.807 |
| Flash Point | 222.7ºC |
| Exact Mass | 330.134644 |
| PSA | 90.65000 |
| LogP | 3.47660 |
| Vapour Pressure | 4.23E-08mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | QPNJISLOYQGQTI-ZOWNYOTGSA-N |
| SMILES | COC(=O)C(N)CCCCNC(=O)OCc1ccccc1.Cl |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00034846 |
| L-Lysine, N-[(phenylmethoxy)carbonyl]-, methyl ester, hydrochloride (1:1) |
| EINECS 248-715-9 |
| Methyl N-[(benzyloxy)carbonyl]-L-lysinate hydrochloride (1:1) |
| N(Epsilon)-Benzyloxycarbonyl-L-Lysine Methyl Ester Hydrochloride |
| H-Lys(Z)-Ome.Hcl |
| H-Lys(Z)-OMe hydrochloride |
| N'-Cbz-L-lysine methyl ester hydrochloride |
| N6-cbz-L-lysine methyl ester hydrochloride |
| N-E-CBZ-L-LYSINE METHYL ESTER HCL |