Aminopeptidase N Inhibitor
Modify Date: 2025-08-20 11:36:24
Aminopeptidase N Inhibitor structure
|
Common Name | Aminopeptidase N Inhibitor | ||
|---|---|---|---|---|
| CAS Number | 596108-59-7 | Molecular Weight | 370.270 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 591.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H10N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.6±30.1 °C | |
Use of Aminopeptidase N InhibitorAminopeptidase N (AP-N) inhibitor is a reversible inhibitor of AP-N/CD13 (IC50 = 25 ��M). |
| Name | [3-Nitro-2-(2-nitrophenyl)-4-oxo-4H-chromen-8-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Aminopeptidase N (AP-N) inhibitor is a reversible inhibitor of AP-N/CD13 (IC50 = 25 ��M). |
|---|---|
| In Vitro | Aminopeptidase N (AP-N) inhibitor is a reversible inhibitor of AP-N/CD13 (IC50 = 25 ��M).It is selective for AP-N/CD13 over matrix metalloproteinase-9 (MMP-9), angiotensin converting enzyme (ACE), neutral endopeptidase (NEP), ��-glutamyl transpeptidase, and the serine proteases dipeptidyl peptidase 4 (DPP-4) and cathepsin G at a concentration of 1 mM. AP-N inhibitor is non-cytotoxic to U937 cells at a concentration of 100 ��M. |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 591.6±50.0 °C at 760 mmHg |
| Molecular Formula | C17H10N2O8 |
| Molecular Weight | 370.270 |
| Flash Point | 311.6±30.1 °C |
| Exact Mass | 370.043701 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | QZDDFQLIQRYMBV-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc2c(=O)c([N+](=O)[O-])c(-c3ccccc3[N+](=O)[O-])oc12 |
| 3-nitro-2-(2-nitrophenyl)-4-oxo-4H-1-benzopyran-8-acetic acid |
| [3-Nitro-2-(2-nitrophenyl)-4-oxo-4H-chromen-8-yl]acetic acid |
| 4H-1-Benzopyran-8-acetic acid, 3-nitro-2-(2-nitrophenyl)-4-oxo- |