XL147
Modify Date: 2025-08-23 18:24:47
XL147 structure
|
Common Name | XL147 | ||
|---|---|---|---|---|
| CAS Number | 956958-53-5 | Molecular Weight | 448.52100 | |
| Density | 1.538 | Boiling Point | N/A | |
| Molecular Formula | C21H16N6O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of XL147Pilaralisib analogue (XL147 analogue) is a representative and selective PI3Kα inhibitor extracted from patent WO2012006552A1, Compound 147 in Table 1. |
| Name | N-[3-(2,1,3-benzothiadiazol-5-ylamino)quinoxalin-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Pilaralisib analogue (XL147 analogue) is a representative and selective PI3Kα inhibitor extracted from patent WO2012006552A1, Compound 147 in Table 1. |
|---|---|
| Related Catalog | |
| Target |
PI3K-alpha |
| References |
| Density | 1.538 |
|---|---|
| Molecular Formula | C21H16N6O2S2 |
| Molecular Weight | 448.52100 |
| Exact Mass | 448.07800 |
| PSA | 149.61000 |
| LogP | 5.06300 |
| InChIKey | MQMKRQLTIWPEDM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2ccc3nsnc3c2)cc1 |
| Storage condition | -20℃ |
| XL 147 |
| XL-147 |
| XL147 |
| PI3K inhibitor X |
| SAR245408 |