2-(5-ethylpyridin-2-yl)-1-phenyl-ethanone structure
|
Common Name | 2-(5-ethylpyridin-2-yl)-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 59576-39-5 | Molecular Weight | 225.28600 | |
| Density | 1.084g/cm3 | Boiling Point | 363.5ºC at 760 mmHg | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | 2-(5-ethylpyridin-2-yl)-1-phenylethanone |
|---|
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760 mmHg |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Flash Point | 181.3ºC |
| Exact Mass | 225.11500 |
| PSA | 29.96000 |
| LogP | 3.06940 |
| Index of Refraction | 1.572 |
| InChIKey | JPVMFUBICIHAON-UHFFFAOYSA-N |
| SMILES | CCc1ccc(CC(=O)c2ccccc2)nc1 |
|
~%
2-(5-ethylpyrid... CAS#:59576-39-5 |
| Literature: Goldberg; Levine Journal of the American Chemical Society, 1955 , vol. 77, p. 3647 |
|
~%
2-(5-ethylpyrid... CAS#:59576-39-5 |
| Literature: Smith et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3997,3998 |
|
~%
Detail
|
| Literature: Goldberg; Levine Journal of the American Chemical Society, 1955 , vol. 77, p. 3647 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |