2-(2-methyl-2H-pyridin-1-yl)-1-phenyl-ethanone structure
|
Common Name | 2-(2-methyl-2H-pyridin-1-yl)-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 32896-98-3 | Molecular Weight | 292.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-methylpyridin-1-ium-1-yl)-1-phenylethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14BrNO |
|---|---|
| Molecular Weight | 292.17100 |
| Exact Mass | 291.02600 |
| PSA | 20.95000 |
| InChIKey | ZBZRFOFIUVGXRA-UHFFFAOYSA-M |
| SMILES | Cc1cccc[n+]1CC(=O)c1ccccc1.[Br-] |
| HS Code | 2933399090 |
|---|
|
~86%
2-(2-methyl-2H-... CAS#:32896-98-3 |
| Literature: F2G LTD Patent: WO2008/62182 A1, 2008 ; Location in patent: Page/Page column 165 ; |
|
~%
Detail
|
| Literature: Wang, Qi-Fang; Hui, Li; Hou, Hong; Yan, Chao-Guo Journal of Combinatorial Chemistry, 2010 , vol. 12, # 2 p. 260 - 265 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS2858N09 |
| 2-methyl-1-(2-oxo-2-phenylethyl)pyridinium bromide |
| N-benzoylmethyl-2-methylpyridinium bromide |
| 1-benzoyl-2-methylpyridinium bromide |
| N-phenacyl-2-methylpyridinium bromide |
| 2-methyl-1-phenacylpyridinium bromide |