3'-Azido-3'-deoxyadenosine structure
|
Common Name | 3'-Azido-3'-deoxyadenosine | ||
|---|---|---|---|---|
| CAS Number | 58699-62-0 | Molecular Weight | 292.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-Azido-3'-deoxyadenosine3'-Azido-3'-deoxyadenosine is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 3'-Azido-3'-deoxyadenosine |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-Azido-3'-deoxyadenosine is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H12N8O3 |
|---|---|
| Molecular Weight | 292.25 |
| Exact Mass | 292.10300 |
| PSA | 169.06000 |
| InChIKey | HTWSTKVLFZRAPM-QYYRPYCUSA-N |
| SMILES | [N-]=[N+]=NC1C(CO)OC(n2cnc3c(N)ncnc32)C1O |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 9-(3'-azido-3'-dideoxy-β-D-ribofuranosyl)adenine |
| 9-(3-Azido-3-desoxy-β-D-ribofuranosyl)adenin |
| 3'-Azido-3'-deoxyadenosin |
| 3'-azido-3'-deoxy-adenosine |
| 9-(3-Azido-3-desoxy-ss-D-ribofuranosyl)adenin |
| 3'-azido-3'-deoxyadenosine |