SB 737050A
Modify Date: 2025-12-02 23:40:15
SB 737050A structure
|
Common Name | SB 737050A | ||
|---|---|---|---|---|
| CAS Number | 583045-76-5 | Molecular Weight | 463.01 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 602.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H23ClN2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.2±34.3 °C | |
Use of SB 737050ASB-737050A is a potent 5-HT6 antagonist to prevent relapse into addiction[1]. |
| Name | 4-(5-Chloro-2-thienyl)-N-(8-methoxy-3-methyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | SB-737050A is a potent 5-HT6 antagonist to prevent relapse into addiction[1]. |
|---|---|
| Related Catalog | |
| Target |
5-HT6 Receptor |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.5±65.0 °C at 760 mmHg |
| Molecular Formula | C22H23ClN2O3S2 |
| Molecular Weight | 463.01 |
| Flash Point | 318.2±34.3 °C |
| Exact Mass | 462.083862 |
| LogP | 5.09 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | FFSKQESNYWHALV-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1NS(=O)(=O)c1ccc(-c3ccc(Cl)s3)cc1)CCN(C)CC2 |
| 4-(5-Chloro-2-thienyl)-N-(8-methoxy-3-methyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)benzenesulfonamide |
| Benzenesulfonamide, 4-(5-chloro-2-thienyl)-N-(2,3,4,5-tetrahydro-8-methoxy-3-methyl-1H-3-benzazepin-7-yl)- |