Trimethylene glycol di-p-chlorobenzoate
Modify Date: 2025-09-18 21:58:48
Trimethylene glycol di-p-chlorobenzoate structure
|
Common Name | Trimethylene glycol di-p-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 57847-60-6 | Molecular Weight | 353.19700 | |
| Density | 1.325g/cm3 | Boiling Point | 468.5ºC at 760 mmHg | |
| Molecular Formula | C17H14Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3ºC | |
| Name | 3-(4-chlorobenzoyl)oxypropyl 4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 468.5ºC at 760 mmHg |
| Molecular Formula | C17H14Cl2O4 |
| Molecular Weight | 353.19700 |
| Flash Point | 177.3ºC |
| Exact Mass | 352.02700 |
| PSA | 52.60000 |
| LogP | 4.39730 |
| Index of Refraction | 1.577 |
| InChIKey | XXVLEKQHSJKZEG-UHFFFAOYSA-N |
| SMILES | O=C(OCCCOC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
Trimethylene gl... CAS#:57847-60-6 |
| Literature: Heim; Poe Journal of Organic Chemistry, 1944 , vol. 9, p. 299 |
|
~%
Trimethylene gl... CAS#:57847-60-6 |
| Literature: Heim; Poe Journal of Organic Chemistry, 1944 , vol. 9, p. 299 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,3-bis-(4-chloro-benzoyloxy)-propane |
| Trimethylenglycoldi-p-chlorbenzoat |
| Benzoic acid,1,3-propanediyl ester |
| 1,3-Bis-(4-chlor-benzoyloxy)-propan |
| Trimethylenglykol-bis-<4-chlor-benzoat> |
| propane-1,3-diyl bis(4-chlorobenzoate) |