2-(6-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol structure
|
Common Name | 2-(6-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 5746-27-0 | Molecular Weight | 282.26 | |
| Density | 2.12g/cm3 | Boiling Point | 723.5ºC at 760mmHg | |
| Molecular Formula | C10H14N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.4ºC | |
Use of 2-(6-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diolN6-Aminoadenosine is an adenosine analogue. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. The popular products in this series are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 9H-Purine, 6-hydrazino-9-.β.-D-ribofuranosyl |
|---|---|
| Synonym | More Synonyms |
| Description | N6-Aminoadenosine is an adenosine analogue. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. The popular products in this series are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.12g/cm3 |
|---|---|
| Boiling Point | 723.5ºC at 760mmHg |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 |
| Flash Point | 391.4ºC |
| Exact Mass | 282.10800 |
| PSA | 154.80000 |
| InChIKey | DGKZTAGCCXJUAT-KQYNXXCUSA-N |
| SMILES | NNc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 4 | |
| 7-benzyl-6-hydrazino-7H-purine |
| 6-Hydrazino-7-benzyl-7H-purin |
| N6-hydrazinoadenosine |
| 7-benzyl-6-hydrazinyl-7h-purine |
| N6-aminoadenosine |