Vitamin K4 structure
|
Common Name | Vitamin K4 | ||
|---|---|---|---|---|
| CAS Number | 573-20-6 | Molecular Weight | 258.269 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 388.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | 113 °C | |
| MSDS | Chinese USA | Flash Point | 195.1±23.0 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
Use of Vitamin K4Vitamin K4 is a chemically synthesized Vitamin K which plays an important role in the normal blood coagulation system. |
| Name | Menadiol Diacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Vitamin K4 is a chemically synthesized Vitamin K which plays an important role in the normal blood coagulation system. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.9±30.0 °C at 760 mmHg |
| Melting Point | 113 °C |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.269 |
| Flash Point | 195.1±23.0 °C |
| Exact Mass | 258.089203 |
| PSA | 52.60000 |
| LogP | 2.67 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | RYWSYCQQUDFMAU-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc(C)c(OC(C)=O)c2ccccc12 |
| Storage condition | 2~8 ℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 + P310 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| RTECS | QJ5250000 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Vitamin K4 induces tumor cytotoxicity in human prostate carcinoma PC-3 cells via the mitochondria-related apoptotic pathway. Jiang Y, et.al.
Pharmazie 68 , 442-448, (2013)
|
|
|
One-Pot Hydroacetylation of Menadione (Vitamin K3) to Menadiol Diacetate (Vitamin K4) by Heterogeneous Catalysis. Dobrinescu C, et.al.
Adv. Synth. Catal. 354 , 1301-1306, (2012)
|
| 2-Methyl-1,4-naphthalenediol Diacetate |
| MFCD00021469 |
| 2-Methyl-1,4-naphthalenediyl diacetate |
| (4-acetyloxy-3-methylnaphthalen-1-yl) acetate |
| 1,4-Naphthalenediol, 2-methyl-, diacetate |
| Kappaxan (VAN) |
| 2-Methylnaphthalene-1,4-diyl diacetate |
| EINECS 209-352-1 |
| Vitamin K4 |