menadiol dibutyrate
Modify Date: 2025-08-26 10:04:11
menadiol dibutyrate structure
|
Common Name | menadiol dibutyrate | ||
|---|---|---|---|---|
| CAS Number | 53370-44-8 | Molecular Weight | 314.37600 | |
| Density | 1.118g/cm3 | Boiling Point | 439.1ºC at 760 mmHg | |
| Molecular Formula | C19H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | (4-butanoyloxy-3-methylnaphthalen-1-yl) butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 439.1ºC at 760 mmHg |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.37600 |
| Flash Point | 216.9ºC |
| Exact Mass | 314.15200 |
| PSA | 52.60000 |
| LogP | 4.55920 |
| Index of Refraction | 1.554 |
| InChIKey | TUWJQNVAGYRRHA-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Oc1cc(C)c(OC(=O)CCC)c2ccccc12 |
| HS Code | 2915900090 |
|---|
|
~%
menadiol dibutyrate CAS#:53370-44-8 |
| Literature: Ansbacher; Fernholz; Dolliver Journal of the American Chemical Society, 1940 , vol. 62, p. 155,156 |
|
~%
menadiol dibutyrate CAS#:53370-44-8 |
| Literature: Ansbacher; Fernholz; Dolliver Journal of the American Chemical Society, 1940 , vol. 62, p. 155,156 |
|
~%
menadiol dibutyrate CAS#:53370-44-8 |
| Literature: Merck,E. Patent: DE734220 , 1940 ; DRP/DRBP Org.Chem. |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| (2-Methyl-naphthalindiyl-(1.4))-dibutyrat |
| 1,4-bis-butyryloxy-2-methyl-naphthalene |
| 2-Methyl-1,4-naphthohydrochinon-dibutyrat [German] |
| Karanum |
| Karanum [German] |
| Vitamin K4-dibutyrat [German] |
| Menadiol-dibutyrat [German] |
| Menadiol dibutyrate |
| 2-Methyl-1,4-naphthalenediol dibutyrate |
| 1,4-Bis-butyryloxy-2-methyl-naphthalin |
| 1.4-Dibutyryloxy-2-methyl-naphthalin |
| 1,4-NAPHTHALENEDIOL,2-METHYL-,DIBUTYRATE |
| (2-Methyl-naphthylen-(1.4))-dibutyrat |