20-Deoxyingenol structure
|
Common Name | 20-Deoxyingenol | ||
|---|---|---|---|---|
| CAS Number | 54706-99-9 | Molecular Weight | 332.434 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 470.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.4±25.2 °C | |
Use of 20-Deoxyingenol20-Deoxyingenol is a natural compound. |
| Name | 20-deoxyingenol |
|---|---|
| Synonym | More Synonyms |
| Description | 20-Deoxyingenol is a natural compound. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.5±45.0 °C at 760 mmHg |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.434 |
| Flash Point | 252.4±25.2 °C |
| Exact Mass | 332.198761 |
| PSA | 77.76000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | FOSYZKSOJUQLTD-NHPMXQBPSA-N |
| SMILES | CC1=CC2C(=O)C3(C=C(C)C(O)C3(O)C1O)C(C)CC1C2C1(C)C |
| Storage condition | -20°C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 1H-2,8a-Methanocyclopenta[a]cyclopropa[e]cyclodecen-11-one, 1a,2,5,5a,6,9,10,10a-octahydro-5,5a,6-trihydroxy-1,1,4,7,9-pentamethyl-, (1aR,2S,5R,5aS,6S,8aS,9R,10aR)- |
| (1S,4S,5S,6R,9S,10R,12R,14R)-4,5,6-Trihydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.0.0]pentadeca-2,7-dien-15-one |