a-D-Xylofuranose, tetrabenzoate(9CI) structure
|
Common Name | a-D-Xylofuranose, tetrabenzoate(9CI) | ||
|---|---|---|---|---|
| CAS Number | 5432-87-1 | Molecular Weight | 566.55400 | |
| Density | 1.36g/cm3 | Boiling Point | 688.2ºC at 760 mmHg | |
| Molecular Formula | C33H26O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.3ºC | |
| Name | (3S)-1,2,3,4-tetrahydrobenzo[h]quinolin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 688.2ºC at 760 mmHg |
| Molecular Formula | C33H26O9 |
| Molecular Weight | 566.55400 |
| Flash Point | 288.3ºC |
| Exact Mass | 566.15800 |
| PSA | 114.43000 |
| LogP | 4.87650 |
| Index of Refraction | 1.639 |
| InChIKey | SVVKRZQAFRVDED-AKDVNAHLSA-N |
| SMILES | O=C(OCC1OC(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2932190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1,2,3,5-tetra-O-benzoyl-D-xylofuranose |