a-D-Xylofuranose,1,2-O-(1-methylethylidene)-, 5-(methyl carbonate) (9CI) structure
|
Common Name | a-D-Xylofuranose,1,2-O-(1-methylethylidene)-, 5-(methyl carbonate) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5432-33-7 | Molecular Weight | 248.23000 | |
| Density | 1.27 g/cm3 | Boiling Point | 353.7ºC at 760 mmHg | |
| Molecular Formula | C10H16O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 134.9ºC | |
| Name | 5-o-carbomethoxy-1,2-o-isopropylidene-d-xylofuranose |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27 g/cm3 |
|---|---|
| Boiling Point | 353.7ºC at 760 mmHg |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23000 |
| Flash Point | 134.9ºC |
| Exact Mass | 248.09000 |
| PSA | 83.45000 |
| LogP | 0.00670 |
| Index of Refraction | 1.467 |
| InChIKey | GGDOHLQEKFUTGN-ULAWRXDQSA-N |
| SMILES | COC(=O)OCC1OC2OC(C)(C)OC2C1O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| 5-O-carbomethoxy-1,2-O-isopropylidene-*D-xylofura |
| MFCD00015881 |
| 1,2-O-isopropylidene-5-O-methoxycarbonyl-D-xylofuranose |
| 5-O-Carbomethoxy-1,2-O-isopropylidene-a-D-xylofuranose |
| (6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl methyl carbonate |
| 5-O-CARBOMETHOXY-1,2-O-ISOPROPYLIDENE-D-XYLOFURANO |
| carbonic acid (6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl methyl ester |