3H-Xanthen-3-one,2,6,7-trihydroxy-9-methyl- structure
|
Common Name | 3H-Xanthen-3-one,2,6,7-trihydroxy-9-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5407-46-5 | Molecular Weight | 258.22600 | |
| Density | 1.63g/cm3 | Boiling Point | 610.5ºC at 760mmHg | |
| Molecular Formula | C14H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.6ºC | |
| Name | 2,6,7-trihydroxy-9-methylxanthen-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 610.5ºC at 760mmHg |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.22600 |
| Flash Point | 241.6ºC |
| Exact Mass | 258.05300 |
| PSA | 90.90000 |
| LogP | 2.32300 |
| Index of Refraction | 1.761 |
| InChIKey | TZVNNUHRZXQCHM-UHFFFAOYSA-N |
| SMILES | Cc1c2cc(O)c(=O)cc-2oc2cc(O)c(O)cc12 |
|
~%
3H-Xanthen-3-on... CAS#:5407-46-5 |
| Literature: Duckert Helvetica Chimica Acta, 1937 , vol. 20, p. 362,364 |
|
~%
3H-Xanthen-3-on... CAS#:5407-46-5 |
| Literature: Liebermann; Lindenbaum Chemische Berichte, 1904 , vol. 37, p. 1177,2731 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6,7-Trihydroxy-9-methyl-xanthen-3-on |
| 2,6,7-Trihydroxy-9-methyl-xanthen-3-one |
| 3H-Xanthen-3-one,2,6,7-trihydroxy-9-methyl |
| EINECS 226-468-8 |
| 9-methyl-2,3,7-trihydroxy-6-fluorone |