3H-Xanthen-3-one,2,6,7-trihydroxy-9-(2-hydroxyphenyl)- structure
|
Common Name | 3H-Xanthen-3-one,2,6,7-trihydroxy-9-(2-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 3569-82-2 | Molecular Weight | 336.295 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 689.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.2±25.0 °C | |
| Name | 2,6,7-trihydroxy-9-(2-hydroxyphenyl)xanthen-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 689.5±55.0 °C at 760 mmHg |
| Molecular Formula | C19H12O6 |
| Molecular Weight | 336.295 |
| Flash Point | 258.2±25.0 °C |
| Exact Mass | 336.063385 |
| PSA | 111.13000 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.828 |
| InChIKey | GRWQEXZZWRVXDZ-UHFFFAOYSA-N |
| SMILES | O=c1cc2oc3cc(O)c(O)cc3c(-c3ccccc3O)c-2cc1O |
| HS Code | 2932999099 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Salicylfluoron |
| 2,6,7-Trihydroxy-9-(2-hydroxy-phenyl)-xanthen-3-on |
| 3H-Xanthen-3-one, 2,6,7-trihydroxy-9-(2-hydroxyphenyl)- |
| 9-HPF |
| 2,6,7-trihydroxy-9-(2-hydroxy-phenyl)-xanthen-3-one |
| 2-Hydroxyphenylfluorone |
| 9-(2-Hydroxyphenyl)-2,3,7-trihydroxyfluorone |
| F0777-0978 |
| o-Hydroxyphenylfluorone |
| salicylfluorone |
| 2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one |
| 9-Hydroxyphenylfluoron |