Fmoc-leucine-d3 structure
|
Common Name | Fmoc-leucine-d3 | ||
|---|---|---|---|---|
| CAS Number | 538372-74-6 | Molecular Weight | 356.43 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 559.8±33.0 °C at 760 mmHg | |
| Molecular Formula | C21H20D3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.4±25.4 °C | |
Use of Fmoc-leucine-d3Fmoc-leucine-d3 is the deuterium labeled Fmoc-leucine. Fmoc-leucine is a selective PPARγ modulator. Fmoc-leucine activates PPARγ with a lower potency but a similar maximal efficacy than rosiglitazone. Fmoc-leucine improves insulin sensitivity in normal, diet-induced glucose-intolerant, and in diabetic db/db mice. Fmoc-leucine has a lower adipogenic activity[1]. |
| Name | (((9H-fluoren-9-yl)methoxy)carbonyl)-L-leucine-5,5,5-d3 |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-leucine-d3 is the deuterium labeled Fmoc-leucine. Fmoc-leucine is a selective PPARγ modulator. Fmoc-leucine activates PPARγ with a lower potency but a similar maximal efficacy than rosiglitazone. Fmoc-leucine improves insulin sensitivity in normal, diet-induced glucose-intolerant, and in diabetic db/db mice. Fmoc-leucine has a lower adipogenic activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.8±33.0 °C at 760 mmHg |
| Molecular Formula | C21H20D3NO4 |
| Molecular Weight | 356.43 |
| Flash Point | 292.4±25.4 °C |
| Exact Mass | 356.181549 |
| PSA | 75.63000 |
| LogP | 4.95 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | CBPJQFCAFFNICX-FIBGUPNXSA-N |
| SMILES | CC(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Storage condition | 2-8°C |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-(5',5',5'-H)leucine |
| L-Leucine-5',5',5'-d, N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |