O-1918 structure
|
Common Name | O-1918 | ||
|---|---|---|---|---|
| CAS Number | 536697-79-7 | Molecular Weight | 286.409 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 383.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C19H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.6±27.4 °C | |
Use of O-1918O-1918 is a cannabidiol analog which acts as a selective antagonist of abnormal cannabidiol at the non-CB1/CB2 endothelial receptor. |
| Name | 1,3-dimethoxy-5-methyl-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.9±42.0 °C at 760 mmHg |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.409 |
| Flash Point | 134.6±27.4 °C |
| Exact Mass | 286.193268 |
| PSA | 18.46000 |
| LogP | 6.08 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | ICHJMVMWPKLUKT-UHFFFAOYSA-N |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OC)cc(C)cc1OC |
| Benzene, 1,3-dimethoxy-5-methyl-2-[(1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]- |
| Benzene, 1,3-dimethoxy-5-methyl-2-[3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]- |
| 2-(6-Isopropenyl-3-methyl-2-cyclohexen-1-yl)-1,3-dimethoxy-5-methylbenzene |
| o-1918 |
| 2-[(1R,6R)-6-Isopropenyl-3-methyl-2-cyclohexen-1-yl]-1,3-dimethoxy-5-methylbenzene |