6,7-Dihydroxy-4-methyl-2H-chromen-2-one structure
|
Common Name | 6,7-Dihydroxy-4-methyl-2H-chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 529-84-0 | Molecular Weight | 192.168 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 455.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H8O4 | Melting Point | 274-276 °C(lit.) | |
| MSDS | N/A | Flash Point | 190.8±22.2 °C | |
Use of 6,7-Dihydroxy-4-methyl-2H-chromen-2-one4-Methylesculetin is an orally active natural coumarin derivative, with potent anti-oxidant and anti-inflammatory activities. 4-Methylesculetin inhibits myeloperoxidase activity and reduces IL-6 level[1]. |
| Name | 4-methylesculetin |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Methylesculetin is an orally active natural coumarin derivative, with potent anti-oxidant and anti-inflammatory activities. 4-Methylesculetin inhibits myeloperoxidase activity and reduces IL-6 level[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.5±45.0 °C at 760 mmHg |
| Melting Point | 274-276 °C(lit.) |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.168 |
| Flash Point | 190.8±22.2 °C |
| Exact Mass | 192.042252 |
| PSA | 70.67000 |
| LogP | 2.08 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | KVOJTUXGYQVLAJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(O)c(O)cc12 |
| Storage condition | 2-8°C |
| Water Solubility | DMF: soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 2 |
| RTECS | GN6384500 |
| HS Code | 2932209090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-Dihydroxy-4-methylcoumarin |
| 4-Methylesculetin |
| EINECS 208-470-0 |
| MFCD00006859 |
| 6,7-Dihydroxy-4-methyl-2H-chromen-2-one |
| 2H-1-Benzopyran-2-one, 6,7-dihydroxy-4-methyl- |
| 6,7-dihydroxy-4-methylchromen-2-one |