6,7-Dimethoxy-4-methylcoumarin structure
|
Common Name | 6,7-Dimethoxy-4-methylcoumarin | ||
|---|---|---|---|---|
| CAS Number | 4281-40-7 | Molecular Weight | 220.22100 | |
| Density | 1.202g/cm3 | Boiling Point | 374.5ºC at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | 136-139 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 168.2ºC | |
| Name | 6,7-Dimethoxy-4-methylcoumarin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 374.5ºC at 760 mmHg |
| Melting Point | 136-139 °C(lit.) |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 168.2ºC |
| Exact Mass | 220.07400 |
| PSA | 48.67000 |
| LogP | 2.11860 |
| Index of Refraction | 1.544 |
| InChIKey | GBYDSYPGGDKWGZ-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(=O)cc(C)c2cc1OC |
| Water Solubility | DMSO: soluble |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-dimethoxy-4-methylchromen-2-one |
| MFCD00012338 |